Products 1269027-12-4

CAS 1269027-12-4 is the registry number for Ethyl 2-chloro-4-vinylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-chloro-4-ethenylbenzoate (CAS 1269027-12-4) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: ethyl 2-chloro-4-ethenylbenzoate. InChIKey: ZWGNRWKABUQCEA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClO2
Molecular weight210.65 g/mol
IUPAC nameethyl 2-chloro-4-ethenylbenzoate
InChIKeyZWGNRWKABUQCEA-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=C(C=C1)C=C)Cl

Computed by PubChem (NCBI)