Products 2387419-80-7
CAS 2387419-80-7 appears in our catalog under these names: (E)-3-(4-Chloro-3,5-dimethylphenyl)acrylic acid, 95%, 3-(4-Chloro-3,5-dimethylphenyl)acrylic acid, 98%, (E)-3-(4-chloro-3,5-dimethylphenyl)acrylic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
(E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoic acid (CAS 2387419-80-7) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: (E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoic acid. InChIKey: FODFWRMFSXKREK-ONEGZZNKSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | (E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoic acid |
| InChIKey | FODFWRMFSXKREK-ONEGZZNKSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C)/C=C/C(=O)O |
Computed by PubChem (NCBI)