Products 1226178-88-6
CAS 1226178-88-6 appears in our catalog under these names: 2-[1-(2-Chlorophenyl)cyclopropyl]acetic acid, 95%, 2-(1-(2-Chlorophenyl)cyclopropyl)acetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-[1-(2-chlorophenyl)cyclopropyl]acetic acid (CAS 1226178-88-6) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: 2-[1-(2-chlorophenyl)cyclopropyl]acetic acid. InChIKey: GAQITOVSCSNDTC-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | 2-[1-(2-chlorophenyl)cyclopropyl]acetic acid |
| InChIKey | GAQITOVSCSNDTC-UHFFFAOYSA-N |
| SMILES | C1CC1(CC(=O)O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)