Products 1016725-49-7

CAS 1016725-49-7 is the registry number for 3-(5-Bromothiophen-2-yl)-2-oxopropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-(5-bromothiophen-2-yl)-2-oxopropanoic acid (CAS 1016725-49-7) is a chemical compound with the molecular formula C7H5BrO3S and a molecular weight of 249.08 g/mol. IUPAC name: 3-(5-bromothiophen-2-yl)-2-oxopropanoic acid. InChIKey: GJPZYQRSPGPTFL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrO3S
Molecular weight249.08 g/mol
IUPAC name3-(5-bromothiophen-2-yl)-2-oxopropanoic acid
InChIKeyGJPZYQRSPGPTFL-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)Br)CC(=O)C(=O)O

Computed by PubChem (NCBI)

Synonyms: starbld0023613