Products 1369239-73-5

CAS 1369239-73-5 is the registry number for 5-Acetyl-4-bromothiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-acetyl-4-bromothiophene-2-carboxylic acid (CAS 1369239-73-5) is a chemical compound with the molecular formula C7H5BrO3S and a molecular weight of 249.08 g/mol. IUPAC name: 5-acetyl-4-bromothiophene-2-carboxylic acid. InChIKey: DPSOMJWTJDUILY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrO3S
Molecular weight249.08 g/mol
IUPAC name5-acetyl-4-bromothiophene-2-carboxylic acid
InChIKeyDPSOMJWTJDUILY-UHFFFAOYSA-N
SMILESCC(=O)C1=C(C=C(S1)C(=O)O)Br

Computed by PubChem (NCBI)