CAS 1545103-73-8 is the registry number for 3-(3-Bromothiophen-2-yl)-2-oxopropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3-bromothiophen-2-yl)-2-oxopropanoic acid (CAS 1545103-73-8) is a chemical compound with the molecular formula C7H5BrO3S and a molecular weight of 249.08 g/mol. IUPAC name: 3-(3-bromothiophen-2-yl)-2-oxopropanoic acid. InChIKey: JZUJOIBEDHRROV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrO3S |
|---|---|
| Molecular weight | 249.08 g/mol |
| IUPAC name | 3-(3-bromothiophen-2-yl)-2-oxopropanoic acid |
| InChIKey | JZUJOIBEDHRROV-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1Br)CC(=O)C(=O)O |
Computed by PubChem (NCBI)