Products 1155083-00-3

CAS 1155083-00-3 is the registry number for 3-(4-Bromothiophen-2-yl)-2-oxopropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(4-bromothiophen-2-yl)-2-oxopropanoic acid (CAS 1155083-00-3) is a chemical compound with the molecular formula C7H5BrO3S and a molecular weight of 249.08 g/mol. IUPAC name: 3-(4-bromothiophen-2-yl)-2-oxopropanoic acid. InChIKey: HYBLZCIEQJZECH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrO3S
Molecular weight249.08 g/mol
IUPAC name3-(4-bromothiophen-2-yl)-2-oxopropanoic acid
InChIKeyHYBLZCIEQJZECH-UHFFFAOYSA-N
SMILESC1=C(SC=C1Br)CC(=O)C(=O)O

Computed by PubChem (NCBI)