Products 2279130-80-0

CAS 2279130-80-0 is the registry number for 2-Acetyl-5-bromothiophene-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-acetyl-5-bromothiophene-3-carboxylic acid (CAS 2279130-80-0) is a chemical compound with the molecular formula C7H5BrO3S and a molecular weight of 249.08 g/mol. IUPAC name: 2-acetyl-5-bromothiophene-3-carboxylic acid. InChIKey: LJLXXVAFJBPXOR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrO3S
Molecular weight249.08 g/mol
IUPAC name2-acetyl-5-bromothiophene-3-carboxylic acid
InChIKeyLJLXXVAFJBPXOR-UHFFFAOYSA-N
SMILESCC(=O)C1=C(C=C(S1)Br)C(=O)O

Computed by PubChem (NCBI)