CAS 1016737-41-9 is the registry number for 4-(3-Aminophenyl)-1,2,4-triazolidine-3,5-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(3-aminophenyl)-1,2,4-triazolidine-3,5-dione (CAS 1016737-41-9) is a chemical compound with the molecular formula C8H8N4O2 and a molecular weight of 192.17 g/mol. IUPAC name: 4-(3-aminophenyl)-1,2,4-triazolidine-3,5-dione. InChIKey: BFJOZDNKANUEHN-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O2 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 4-(3-aminophenyl)-1,2,4-triazolidine-3,5-dione |
| InChIKey | BFJOZDNKANUEHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C(=O)NNC2=O)N |
Computed by PubChem (NCBI)