CAS 1016744-86-7 is the registry number for 2-(4-(1-Aminoethyl)phenyl)-1,2-thiazolidine-1,1-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]ethanamine (CAS 1016744-86-7) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: 1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]ethanamine. InChIKey: ZYDYTIIIADYIDK-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | 1-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]ethanamine |
| InChIKey | ZYDYTIIIADYIDK-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)N2CCCS2(=O)=O)N |
Computed by PubChem (NCBI)