CAS 1016755-99-9 is the registry number for (4-Methylthiazole-5-carbonyl)glycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-methyl-1,3-thiazole-5-carbonyl)amino]acetic acid (CAS 1016755-99-9) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: 2-[(4-methyl-1,3-thiazole-5-carbonyl)amino]acetic acid. InChIKey: GTZUTNYENUTCSI-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | 2-[(4-methyl-1,3-thiazole-5-carbonyl)amino]acetic acid |
| InChIKey | GTZUTNYENUTCSI-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)