CAS 1016771-84-8 appears in our catalog under these names: 4-(3-Aminophenyl)-4,5-dihydro-1H-1,2,4-triazol-5-one, 95%, 4-(3-Aminophenyl)-4,5-dihydro-1H-1,2,4-triazol-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(3-aminophenyl)-1H-1,2,4-triazol-5-one (CAS 1016771-84-8) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: 4-(3-aminophenyl)-1H-1,2,4-triazol-5-one. InChIKey: YAJUDAWYSQPFKK-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 4-(3-aminophenyl)-1H-1,2,4-triazol-5-one |
| InChIKey | YAJUDAWYSQPFKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=NNC2=O)N |
Computed by PubChem (NCBI)