Products 1016822-12-0

CAS 1016822-12-0 is the registry number for 3-(4-(Chlorosulfonyl)-2-methylphenoxy)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-(4-chlorosulfonyl-2-methylphenoxy)propanoic acid (CAS 1016822-12-0) is a chemical compound with the molecular formula C10H11ClO5S and a molecular weight of 278.71 g/mol. IUPAC name: 3-(4-chlorosulfonyl-2-methylphenoxy)propanoic acid. InChIKey: DSPOCWCVUVRRPB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO5S
Molecular weight278.71 g/mol
IUPAC name3-(4-chlorosulfonyl-2-methylphenoxy)propanoic acid
InChIKeyDSPOCWCVUVRRPB-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)S(=O)(=O)Cl)OCCC(=O)O

Computed by PubChem (NCBI)