CAS 1240528-80-6 is the registry number for 2-(3-(Chlorosulfonyl)-2,6-dimethylphenoxy)acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(3-chlorosulfonyl-2,6-dimethylphenoxy)acetic acid (CAS 1240528-80-6) is a chemical compound with the molecular formula C10H11ClO5S and a molecular weight of 278.71 g/mol. IUPAC name: 2-(3-chlorosulfonyl-2,6-dimethylphenoxy)acetic acid. InChIKey: NYYCVCUBZGTFST-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO5S |
|---|---|
| Molecular weight | 278.71 g/mol |
| IUPAC name | 2-(3-chlorosulfonyl-2,6-dimethylphenoxy)acetic acid |
| InChIKey | NYYCVCUBZGTFST-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)S(=O)(=O)Cl)C)OCC(=O)O |
Computed by PubChem (NCBI)