Products 1240528-80-6

CAS 1240528-80-6 is the registry number for 2-(3-(Chlorosulfonyl)-2,6-dimethylphenoxy)acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-chlorosulfonyl-2,6-dimethylphenoxy)acetic acid (CAS 1240528-80-6) is a chemical compound with the molecular formula C10H11ClO5S and a molecular weight of 278.71 g/mol. IUPAC name: 2-(3-chlorosulfonyl-2,6-dimethylphenoxy)acetic acid. InChIKey: NYYCVCUBZGTFST-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO5S
Molecular weight278.71 g/mol
IUPAC name2-(3-chlorosulfonyl-2,6-dimethylphenoxy)acetic acid
InChIKeyNYYCVCUBZGTFST-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)S(=O)(=O)Cl)C)OCC(=O)O

Computed by PubChem (NCBI)