CAS 56077-79-3 is the registry number for Methyl 3-[4-(chlorosulfonyl)phenoxy]propanoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 3-(4-chlorosulfonylphenoxy)propanoate (CAS 56077-79-3) is a chemical compound with the molecular formula C10H11ClO5S and a molecular weight of 278.71 g/mol. IUPAC name: methyl 3-(4-chlorosulfonylphenoxy)propanoate. InChIKey: IFEXOLHQPSGXKP-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO5S |
|---|---|
| Molecular weight | 278.71 g/mol |
| IUPAC name | methyl 3-(4-chlorosulfonylphenoxy)propanoate |
| InChIKey | IFEXOLHQPSGXKP-UHFFFAOYSA-N |
| SMILES | COC(=O)CCOC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)