Products 262589-79-7
CAS 262589-79-7 appears in our catalog under these names: Ethyl 3-(chlorosulfonyl)-4-methoxybenzoate, 95%, Ethyl 3-(chlorosulfonyl)-4-methoxybenzoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
Ethyl 3-chlorosulfonyl-4-methoxybenzoate (CAS 262589-79-7) is a chemical compound with the molecular formula C10H11ClO5S and a molecular weight of 278.71 g/mol. IUPAC name: ethyl 3-chlorosulfonyl-4-methoxybenzoate. InChIKey: RMXGNRJELOOOAR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO5S |
|---|---|
| Molecular weight | 278.71 g/mol |
| IUPAC name | ethyl 3-chlorosulfonyl-4-methoxybenzoate |
| InChIKey | RMXGNRJELOOOAR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)