CAS 200575-17-3 is the registry number for Methyl 5-(chlorosulfonyl)-2-ethoxybenzoate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Methyl 5-chlorosulfonyl-2-ethoxybenzoate (CAS 200575-17-3) is a chemical compound with the molecular formula C10H11ClO5S and a molecular weight of 278.71 g/mol. IUPAC name: methyl 5-chlorosulfonyl-2-ethoxybenzoate. InChIKey: WEMPSVOPLDKKRH-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO5S |
|---|---|
| Molecular weight | 278.71 g/mol |
| IUPAC name | methyl 5-chlorosulfonyl-2-ethoxybenzoate |
| InChIKey | WEMPSVOPLDKKRH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)S(=O)(=O)Cl)C(=O)OC |
Computed by PubChem (NCBI)