CAS 1016841-45-4 appears in our catalog under these names: 8-Bromo-4-oxo-1,4-dihydroquinoline-2-carboxylic acid, 95%, 8-Bromo-4-oxo-1,4-dihydroquinoline-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
8-bromo-4-oxo-1H-quinoline-2-carboxylic acid (CAS 1016841-45-4) is a chemical compound with the molecular formula C10H6BrNO3 and a molecular weight of 268.06 g/mol. IUPAC name: 8-bromo-4-oxo-1H-quinoline-2-carboxylic acid. InChIKey: QVLPEZFQNJXXMZ-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO3 |
|---|---|
| Molecular weight | 268.06 g/mol |
| IUPAC name | 8-bromo-4-oxo-1H-quinoline-2-carboxylic acid |
| InChIKey | QVLPEZFQNJXXMZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=CC2=O)C(=O)O |
Computed by PubChem (NCBI)