Products 1017024-01-9

CAS 1017024-01-9 is the registry number for 4-(But-3-yn-1-yloxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-but-3-ynoxybenzoic acid (CAS 1017024-01-9) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 4-but-3-ynoxybenzoic acid. InChIKey: BBXYIDRHSXLQFO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O3
Molecular weight190.19 g/mol
IUPAC name4-but-3-ynoxybenzoic acid
InChIKeyBBXYIDRHSXLQFO-UHFFFAOYSA-N
SMILESC#CCCOC1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)