CAS 1017051-55-6 appears in our catalog under these names: 5-Methyl-2-[(methylsulfonyl)amino]benzoic acid, 97%, 5–Methyl–2–(methylsulfonamido)benzoic Acid, 5-Methyl-2-(methylsulfonamido)benzoic acid, 5-Methyl-2-[(methylsulfonyl)amino]benzoic acid, >97%, >97%, 5-Methyl-2-(methylsulfonamido)benzoic acid, >97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100g, 250mg, 2,5g, 100mg.
2-(methanesulfonamido)-5-methylbenzoic acid (CAS 1017051-55-6) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 2-(methanesulfonamido)-5-methylbenzoic acid. InChIKey: IAVAVGYTZPNJLD-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 2-(methanesulfonamido)-5-methylbenzoic acid |
| InChIKey | IAVAVGYTZPNJLD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)