CAS 1017059-08-3 is the registry number for 3,2',4',5',6-Pentahydroxyflavone. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
3,6-dihydroxy-2-(2,4,5-trihydroxyphenyl)chromen-4-one (CAS 1017059-08-3) is a chemical compound with the molecular formula C15H10O7 and a molecular weight of 302.23 g/mol. IUPAC name: 3,6-dihydroxy-2-(2,4,5-trihydroxyphenyl)chromen-4-one. InChIKey: RVFIXKXGOWFZDL-UHFFFAOYSA-N.
| Molecular formula | C15H10O7 |
|---|---|
| Molecular weight | 302.23 g/mol |
| IUPAC name | 3,6-dihydroxy-2-(2,4,5-trihydroxyphenyl)chromen-4-one |
| InChIKey | RVFIXKXGOWFZDL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=O)C(=C(O2)C3=CC(=C(C=C3O)O)O)O |
Computed by PubChem (NCBI)