CAS 1017060-55-7 is the registry number for 3-Hydroxy-7,2',4',5'-tetramethoxyflavone. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
3-hydroxy-7-methoxy-2-(2,4,5-trimethoxyphenyl)chromen-4-one (CAS 1017060-55-7) is a chemical compound with the molecular formula C19H18O7 and a molecular weight of 358.3 g/mol. IUPAC name: 3-hydroxy-7-methoxy-2-(2,4,5-trimethoxyphenyl)chromen-4-one. InChIKey: JIGPTRZDQGCODU-UHFFFAOYSA-N.
| Molecular formula | C19H18O7 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 3-hydroxy-7-methoxy-2-(2,4,5-trimethoxyphenyl)chromen-4-one |
| InChIKey | JIGPTRZDQGCODU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C(=C(O2)C3=CC(=C(C=C3OC)OC)OC)O |
Computed by PubChem (NCBI)