CAS 1346599-39-0 is the registry number for Eupatorin-d3 5-Methyl Ether. Offered by: TRC. Available pack sizes: 25mg.
2-[3-hydroxy-4-(trideuteriomethoxy)phenyl]-5,6,7-trimethoxychromen-4-one (CAS 1346599-39-0) is a chemical compound with the molecular formula C19H18O7 and a molecular weight of 361.4 g/mol. IUPAC name: 2-[3-hydroxy-4-(trideuteriomethoxy)phenyl]-5,6,7-trimethoxychromen-4-one. InChIKey: LYLDPYNWDVVPIQ-FIBGUPNXSA-N.
| Molecular formula | C19H18O7 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 2-[3-hydroxy-4-(trideuteriomethoxy)phenyl]-5,6,7-trimethoxychromen-4-one |
| InChIKey | LYLDPYNWDVVPIQ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC)OC)OC)O |
Computed by PubChem (NCBI)