CAS 21764-09-0 appears in our catalog under these names: Eupatorin-5-Methyl Ether, Eupatorin 5-methyl ether. Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 250mg, 100mg, 500mg, 1000mg, 5 mg, 1 mg, 10 mg.
2-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxychromen-4-one (CAS 21764-09-0) is a chemical compound with the molecular formula C19H18O7 and a molecular weight of 358.3 g/mol. IUPAC name: 2-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxychromen-4-one. InChIKey: LYLDPYNWDVVPIQ-UHFFFAOYSA-N.
| Molecular formula | C19H18O7 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 2-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxychromen-4-one |
| InChIKey | LYLDPYNWDVVPIQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC)OC)OC)O |
Computed by PubChem (NCBI)