CAS 521-44-8 is the registry number for Flindulatin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
5-hydroxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 521-44-8) is a chemical compound with the molecular formula C19H18O7 and a molecular weight of 358.3 g/mol. IUPAC name: 5-hydroxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: SQOMVBRIXCJFKW-UHFFFAOYSA-N.
| Molecular formula | C19H18O7 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 5-hydroxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | SQOMVBRIXCJFKW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C(=C(C=C3O)OC)OC)OC |
Computed by PubChem (NCBI)