Products 3447-95-8
CAS 3447-95-8 appears in our catalog under these names: Benzofurodil (Benfurodil), Benzofurodil. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, Get quote.
4-[1-[3-methyl-5-(5-oxo-2H-furan-3-yl)-1-benzofuran-2-yl]ethoxy]-4-oxobutanoic acid (CAS 3447-95-8) is a chemical compound with the molecular formula C19H18O7 and a molecular weight of 358.3 g/mol. IUPAC name: 4-[1-[3-methyl-5-(5-oxo-2H-furan-3-yl)-1-benzofuran-2-yl]ethoxy]-4-oxobutanoic acid. InChIKey: URIZBPYQIRFMBF-UHFFFAOYSA-N.
| Molecular formula | C19H18O7 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 4-[1-[3-methyl-5-(5-oxo-2H-furan-3-yl)-1-benzofuran-2-yl]ethoxy]-4-oxobutanoic acid |
| InChIKey | URIZBPYQIRFMBF-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C=C(C=C2)C3=CC(=O)OC3)C(C)OC(=O)CCC(=O)O |
Computed by PubChem (NCBI)