Products 1017216-72-6

CAS 1017216-72-6 is the registry number for 3-(4-(tert-Butyl)phenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4-tert-butylphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1017216-72-6) is a chemical compound with the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. IUPAC name: 3-(4-tert-butylphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: MFMKSWWROYJVRG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17NO3
Molecular weight259.30 g/mol
IUPAC name3-(4-tert-butylphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid
InChIKeyMFMKSWWROYJVRG-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=CC=C(C=C2)C(C)(C)C)C(=O)O

Computed by PubChem (NCBI)