CAS 524959-64-6 appears in our catalog under these names: 2-(5-Methyl-2-phenyl-1,3-oxazol-4-yl)acetonitrile, 95%, 2-(5-Methyl-2-phenyl-1,3-oxazol-4-yl)acetonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetonitrile (CAS 524959-64-6) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetonitrile. InChIKey: ONGPDHWUKNYNRF-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetonitrile |
| InChIKey | ONGPDHWUKNYNRF-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2)CC#N |
Computed by PubChem (NCBI)