CAS 1017777-72-8 appears in our catalog under these names: 6-Chloro-2-fluoro-3-methoxybenzonitrile, 97%, 6-Chloro-2-fluoro-3-methoxybenzonitrile, 98+%, 6-Chloro-2-fluoro-3-methoxybenzonitrile. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g.
6-chloro-2-fluoro-3-methoxybenzonitrile (CAS 1017777-72-8) is a chemical compound with the molecular formula C8H5ClFNO and a molecular weight of 185.58 g/mol. IUPAC name: 6-chloro-2-fluoro-3-methoxybenzonitrile. InChIKey: MRGPSVJVQWPCNB-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO |
|---|---|
| Molecular weight | 185.58 g/mol |
| IUPAC name | 6-chloro-2-fluoro-3-methoxybenzonitrile |
| InChIKey | MRGPSVJVQWPCNB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Cl)C#N)F |
Computed by PubChem (NCBI)