CAS 139549-22-7 appears in our catalog under these names: 2-(Chloromethyl)-4-fluorobenzo(d)oxazole, 95%, 2-(Chloromethyl)-4-fluoro-1,3-benzoxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(chloromethyl)-4-fluoro-1,3-benzoxazole (CAS 139549-22-7) is a chemical compound with the molecular formula C8H5ClFNO and a molecular weight of 185.58 g/mol. IUPAC name: 2-(chloromethyl)-4-fluoro-1,3-benzoxazole. InChIKey: AEOPPVPQYXKXJD-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO |
|---|---|
| Molecular weight | 185.58 g/mol |
| IUPAC name | 2-(chloromethyl)-4-fluoro-1,3-benzoxazole |
| InChIKey | AEOPPVPQYXKXJD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)N=C(O2)CCl |
Computed by PubChem (NCBI)