CAS 1523333-96-1 is the registry number for 4-Chloro-7-fluoroindolin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-7-fluoro-1,3-dihydroindol-2-one (CAS 1523333-96-1) is a chemical compound with the molecular formula C8H5ClFNO and a molecular weight of 185.58 g/mol. IUPAC name: 4-chloro-7-fluoro-1,3-dihydroindol-2-one. InChIKey: DBVZGOGXVMBGMJ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO |
|---|---|
| Molecular weight | 185.58 g/mol |
| IUPAC name | 4-chloro-7-fluoro-1,3-dihydroindol-2-one |
| InChIKey | DBVZGOGXVMBGMJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2NC1=O)F)Cl |
Computed by PubChem (NCBI)