CAS 1427416-36-1 is the registry number for 5-Chloro-7-fluoroisoindolin-1-one, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-chloro-7-fluoro-2,3-dihydroisoindol-1-one (CAS 1427416-36-1) is a chemical compound with the molecular formula C8H5ClFNO and a molecular weight of 185.58 g/mol. IUPAC name: 5-chloro-7-fluoro-2,3-dihydroisoindol-1-one. InChIKey: YEEKJGKVCUBLSI-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO |
|---|---|
| Molecular weight | 185.58 g/mol |
| IUPAC name | 5-chloro-7-fluoro-2,3-dihydroisoindol-1-one |
| InChIKey | YEEKJGKVCUBLSI-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)Cl)F)C(=O)N1 |
Computed by PubChem (NCBI)