Products 143708-36-5
CAS 143708-36-5 appears in our catalog under these names: 2-(Chloromethyl)-6-fluoro-1,3-benzoxazole, 95%, 2-(Chloromethyl)-6-fluoro-1,3-benzoxazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
2-(chloromethyl)-6-fluoro-1,3-benzoxazole (CAS 143708-36-5) is a chemical compound with the molecular formula C8H5ClFNO and a molecular weight of 185.58 g/mol. IUPAC name: 2-(chloromethyl)-6-fluoro-1,3-benzoxazole. InChIKey: JVUWLFQJNVEUSF-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO |
|---|---|
| Molecular weight | 185.58 g/mol |
| IUPAC name | 2-(chloromethyl)-6-fluoro-1,3-benzoxazole |
| InChIKey | JVUWLFQJNVEUSF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)OC(=N2)CCl |
Computed by PubChem (NCBI)