Products 1017779-62-2
CAS 1017779-62-2 appears in our catalog under these names: 4-Ethoxy-2,3-difluorophenylacetic acid, 97%, 4–Ethoxy–2，3–Difluorophenylacetic Acid, 4-Ethoxy-2,3-Difluorophenylacetic Acid, 97%+,RG, 97%+,RG, 4-Ethoxy-2,3-difluorophenylacetic acid, 97%+,RG. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-(4-ethoxy-2,3-difluorophenyl)acetic acid (CAS 1017779-62-2) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: 2-(4-ethoxy-2,3-difluorophenyl)acetic acid. InChIKey: YLQFXSRZIUVTEM-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | 2-(4-ethoxy-2,3-difluorophenyl)acetic acid |
| InChIKey | YLQFXSRZIUVTEM-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)CC(=O)O)F)F |
Computed by PubChem (NCBI)