CAS 1017779-68-8 appears in our catalog under these names: 4'-Ethoxy-2',3'-difluoroacetophenone, 95%, 1-(4-Ethoxy-2,3-difluorophenyl)ethan-1-one 95+%, 4'-Ethoxy-2',3'-difluoroacetophenone, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
1-(4-ethoxy-2,3-difluorophenyl)ethanone (CAS 1017779-68-8) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 1-(4-ethoxy-2,3-difluorophenyl)ethanone. InChIKey: YHGFVKNXGQWJMM-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | 1-(4-ethoxy-2,3-difluorophenyl)ethanone |
| InChIKey | YHGFVKNXGQWJMM-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C(=O)C)F)F |
Computed by PubChem (NCBI)