CAS 1018-47-9 is the registry number for 6-(Chloromethyl)-1h,3h-benzo[de]isochromen-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
8-(chloromethyl)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-one (CAS 1018-47-9) is a chemical compound with the molecular formula C13H9ClO2 and a molecular weight of 232.66 g/mol. IUPAC name: 8-(chloromethyl)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-one. InChIKey: RUKIAFYRUHSJCQ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 8-(chloromethyl)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-one |
| InChIKey | RUKIAFYRUHSJCQ-UHFFFAOYSA-N |
| SMILES | C1C2=C3C(=C(C=C2)CCl)C=CC=C3C(=O)O1 |
Computed by PubChem (NCBI)