Products 1018052-82-8
CAS 1018052-82-8 is the registry number for 5-(3-Chlorophenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-(3-chlorophenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid (CAS 1018052-82-8) is a chemical compound with the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. IUPAC name: 5-(3-chlorophenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid. InChIKey: COPXHIMKUIIRKM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| InChIKey | COPXHIMKUIIRKM-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C(=O)O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)