CAS 54903-62-7 appears in our catalog under these names: 6-(2-Chloroacetyl)-3-methyl-2,3-dihydro-1,3-benzoxazol-2-one, 95%, 6-(2-Chloroacetyl)-3-methyl-2,3-dihydro-1,3-benzoxazol-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
6-(2-chloroacetyl)-3-methyl-1,3-benzoxazol-2-one (CAS 54903-62-7) is a chemical compound with the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. IUPAC name: 6-(2-chloroacetyl)-3-methyl-1,3-benzoxazol-2-one. InChIKey: VDISGHMLFHYHFJ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | 6-(2-chloroacetyl)-3-methyl-1,3-benzoxazol-2-one |
| InChIKey | VDISGHMLFHYHFJ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(=O)CCl)OC1=O |
Computed by PubChem (NCBI)