CAS 612850-65-4 appears in our catalog under these names: 2-Chloro-n-(1-oxo-1,3-dihydro-2-benzofuran-5-yl)acetamide, 95%, 2-Chloro-N-(1-oxo-1,3-dihydroisobenzofuran-5-yl)acetamide, 97%, 2-Chloro-N-(1-oxo-1,3-dihydroisobenzofuran-5-yl)acetamide 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-chloro-N-(1-oxo-3H-2-benzofuran-5-yl)acetamide (CAS 612850-65-4) is a chemical compound with the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. IUPAC name: 2-chloro-N-(1-oxo-3H-2-benzofuran-5-yl)acetamide. InChIKey: MTDACMVGUSPWKD-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | 2-chloro-N-(1-oxo-3H-2-benzofuran-5-yl)acetamide |
| InChIKey | MTDACMVGUSPWKD-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)NC(=O)CCl)C(=O)O1 |
Computed by PubChem (NCBI)