Products 1139838-91-7
CAS 1139838-91-7 appears in our catalog under these names: 3-Amino-4-chloro-benzofuran-2-carboxylic acid methyl ester, 95%, Methyl 3-amino-4-chlorobenzofuran-2-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg.
Methyl 3-amino-4-chloro-1-benzofuran-2-carboxylate (CAS 1139838-91-7) is a chemical compound with the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. IUPAC name: methyl 3-amino-4-chloro-1-benzofuran-2-carboxylate. InChIKey: ZJQDYFQDCCHOKF-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | methyl 3-amino-4-chloro-1-benzofuran-2-carboxylate |
| InChIKey | ZJQDYFQDCCHOKF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(O1)C=CC=C2Cl)N |
Computed by PubChem (NCBI)