Products 757220-09-0
CAS 757220-09-0 appears in our catalog under these names: 2-Chloro-4-cyano-6-methoxyphenyl acetate, 95%, 2-Chloro-4-cyano-6-methoxyphenyl acetate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 0,5g.
(2-chloro-4-cyano-6-methoxyphenyl) acetate (CAS 757220-09-0) is a chemical compound with the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. IUPAC name: (2-chloro-4-cyano-6-methoxyphenyl) acetate. InChIKey: HROKRSOMNQYVBO-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | (2-chloro-4-cyano-6-methoxyphenyl) acetate |
| InChIKey | HROKRSOMNQYVBO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1Cl)C#N)OC |
Computed by PubChem (NCBI)