CAS 1018128-22-7 is the registry number for 2-{(5-(1,3-Dioxaindan-5-yl)-1,2-oxazol-3-yl)methoxy}acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]acetic acid (CAS 1018128-22-7) is a chemical compound with the molecular formula C13H11NO6 and a molecular weight of 277.23 g/mol. IUPAC name: 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]acetic acid. InChIKey: HJGOZNIRPCYTRR-UHFFFAOYSA-N.
| Molecular formula | C13H11NO6 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]acetic acid |
| InChIKey | HJGOZNIRPCYTRR-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=CC(=NO3)COCC(=O)O |
Computed by PubChem (NCBI)