CAS 438220-25-8 is the registry number for 5-((4-Methyl-2-nitrophenoxy)methyl)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxylic acid (CAS 438220-25-8) is a chemical compound with the molecular formula C13H11NO6 and a molecular weight of 277.23 g/mol. IUPAC name: 5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxylic acid. InChIKey: BJTZIXCMABHKFK-UHFFFAOYSA-N.
| Molecular formula | C13H11NO6 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | 5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxylic acid |
| InChIKey | BJTZIXCMABHKFK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC2=CC=C(O2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)