CAS 2705797-38-0 is the registry number for Rel-(2r,5r)-5-(1,3-dioxoisoindolin-2-yl)-1,3-dioxane-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1,3-dioxoisoindol-2-yl)-1,3-dioxane-2-carboxylic acid (CAS 2705797-38-0) is a chemical compound with the molecular formula C13H11NO6 and a molecular weight of 277.23 g/mol. IUPAC name: 5-(1,3-dioxoisoindol-2-yl)-1,3-dioxane-2-carboxylic acid. InChIKey: VGNVSGZZPSKRCL-UHFFFAOYSA-N.
| Molecular formula | C13H11NO6 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | 5-(1,3-dioxoisoindol-2-yl)-1,3-dioxane-2-carboxylic acid |
| InChIKey | VGNVSGZZPSKRCL-UHFFFAOYSA-N |
| SMILES | C1C(COC(O1)C(=O)O)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)