Products 15887-39-5
CAS 15887-39-5 is the registry number for 2,2-dimethyl-5-((2-nitrophenyl)methylene)-1,3-dioxane-4,6-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2,2-dimethyl-5-[(2-nitrophenyl)methylidene]-1,3-dioxane-4,6-dione (CAS 15887-39-5) is a chemical compound with the molecular formula C13H11NO6 and a molecular weight of 277.23 g/mol. IUPAC name: 2,2-dimethyl-5-[(2-nitrophenyl)methylidene]-1,3-dioxane-4,6-dione. InChIKey: GQOZFMSUNUOFQB-UHFFFAOYSA-N.
| Molecular formula | C13H11NO6 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | 2,2-dimethyl-5-[(2-nitrophenyl)methylidene]-1,3-dioxane-4,6-dione |
| InChIKey | GQOZFMSUNUOFQB-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CC2=CC=CC=C2[N+](=O)[O-])C(=O)O1)C |
Computed by PubChem (NCBI)