CAS 139542-56-6 is the registry number for Salfredin C1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[(2R)-4-hydroxy-5,7-dioxo-2,3-dihydrofuro[3,2-f]isoindol-2-yl]propanoic acid (CAS 139542-56-6) is a chemical compound with the molecular formula C13H11NO6 and a molecular weight of 277.23 g/mol. IUPAC name: (2S)-2-[(2R)-4-hydroxy-5,7-dioxo-2,3-dihydrofuro[3,2-f]isoindol-2-yl]propanoic acid. InChIKey: RVAJKUWZAXLXGY-MHTLYPKNSA-N.
| Molecular formula | C13H11NO6 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | (2S)-2-[(2R)-4-hydroxy-5,7-dioxo-2,3-dihydrofuro[3,2-f]isoindol-2-yl]propanoic acid |
| InChIKey | RVAJKUWZAXLXGY-MHTLYPKNSA-N |
| SMILES | C[C@@H]([C@H]1CC2=C(O1)C=C3C(=C2O)C(=O)NC3=O)C(=O)O |
Computed by PubChem (NCBI)