CAS 1018170-77-8 appears in our catalog under these names: 3-((1,2,4)Triazolo(1,5-a)pyrimidin-2-yl)propanoic acid, 97%, 3-{(1,2,4)Triazolo(1,5-a)pyrimidin-2-yl}propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)propanoic acid (CAS 1018170-77-8) is a chemical compound with the molecular formula C8H8N4O2 and a molecular weight of 192.17 g/mol. IUPAC name: 3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)propanoic acid. InChIKey: TXQZVOROAGZEIO-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O2 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)propanoic acid |
| InChIKey | TXQZVOROAGZEIO-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)CCC(=O)O)N=C1 |
Computed by PubChem (NCBI)