CAS 1018229-53-2 appears in our catalog under these names: Ilaprazole Impurity 27, Ilaprazole Impurity 14, 1,3-DIHYDRO-5-(1H-PYRROL-1-YL)-2H-BENZIMIDAZOL-2-ONE, 98%, 98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
5-pyrrol-1-yl-1,3-dihydrobenzimidazol-2-one (CAS 1018229-53-2) is a chemical compound with the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. IUPAC name: 5-pyrrol-1-yl-1,3-dihydrobenzimidazol-2-one. InChIKey: QGCWORNUIDJVFR-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | 5-pyrrol-1-yl-1,3-dihydrobenzimidazol-2-one |
| InChIKey | QGCWORNUIDJVFR-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC3=C(C=C2)NC(=O)N3 |
Computed by PubChem (NCBI)