CAS 1018434-64-4 appears in our catalog under these names: (alphaR)-alpha-(Difluoromethyl)-benzenemethanamine Hydrochloride, (R)-2,2-Difluoro-1-phenylethan-1-amine hydrochloride, 98%, (1R)-2,2-Difluoro-1-phenylethan-1-amine hydrochloride. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
(1R)-2,2-difluoro-1-phenylethanamine;hydrochloride (CAS 1018434-64-4) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: (1R)-2,2-difluoro-1-phenylethanamine;hydrochloride. InChIKey: PRPURMZIWSKOBV-OGFXRTJISA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | (1R)-2,2-difluoro-1-phenylethanamine;hydrochloride |
| InChIKey | PRPURMZIWSKOBV-OGFXRTJISA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(F)F)N.Cl |
Computed by PubChem (NCBI)