CAS 1018454-97-1 appears in our catalog under these names: Thienopyridone, 98%, Thienopyridone, 7-amino-2-phenyl-4H,5H-thieno[3,2-c]pyridin-4-one, Thienopyridone, 95.14%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 50mg, 0,5g, 1mg, 10 mg, 5 mg.
7-amino-2-phenyl-5H-thieno[3,2-c]pyridin-4-one (CAS 1018454-97-1) is a chemical compound with the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. IUPAC name: 7-amino-2-phenyl-5H-thieno[3,2-c]pyridin-4-one. InChIKey: FBVOPOZVLBHOHR-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 7-amino-2-phenyl-5H-thieno[3,2-c]pyridin-4-one |
| InChIKey | FBVOPOZVLBHOHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(S2)C(=CNC3=O)N |
Computed by PubChem (NCBI)